CymitQuimica logo

CAS 163520-14-7

:

Boronic acid,[2-[[(1,1-dimethylethyl)amino]sulfonyl]-5-(2-methylpropyl)-3-thienyl]-

Description:
Boronic acids are a class of organic compounds characterized by the presence of a boron atom bonded to a hydroxyl group and an organic substituent. The specific compound you mentioned, with the CAS number 163520-14-7, features a thienyl group, which is a five-membered aromatic ring containing sulfur. This compound also includes a sulfonamide functional group, indicated by the presence of a sulfonyl moiety attached to a dimethylamino group. The presence of the bulky tert-butyl group suggests that steric hindrance may influence its reactivity and interactions. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. They can also participate in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds in complex organic molecules. Overall, this compound's unique structure may impart specific properties that could be exploited in drug development or materials science.
Formula:C12H22BNO4S2
InChI:InChI=1S/C12H22BNO4S2/c1-8(2)6-9-7-10(13(15)16)11(19-9)20(17,18)14-12(3,4)5/h7-8,14-16H,6H2,1-5H3
InChI key:WNDRLWHRDDJBRR-UHFFFAOYSA-N
SMILES:B(C1=C(SC(=C1)CC(C)C)S(=O)(=O)NC(C)(C)C)(O)O
Found 2 products.