CAS 163520-33-0: 3-Isoxazolecarboxylic acid, 4,5-dihydro-5,5-diphenyl-, ethyl ester
Description:3-Isoxazolecarboxylic acid, 4,5-dihydro-5,5-diphenyl-, ethyl ester is an organic compound characterized by its isoxazole ring structure, which contributes to its unique chemical properties. This compound features a carboxylic acid functional group, indicating its potential for acidic behavior, while the ethyl ester moiety suggests it can undergo hydrolysis to release the corresponding acid. The presence of the diphenyl substituents enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity in various solvents. The dihydro configuration indicates that the compound has a saturated structure at specific positions, which may affect its stability and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 163520-33-0, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, the unique structural features of this compound contribute to its potential utility in diverse chemical applications.
Formula:C18H17NO3
InChI:InChI=1S/C18H17NO3/c1-2-21-17(20)16-13-18(22-19-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3
InChI key:InChIKey=MWKVXOJATACCCH-UHFFFAOYSA-N
SMILES:O=C(OCC)C1=NOC(C=2C=CC=CC2)(C=3C=CC=CC3)C1
- Synonyms:
- 3-Isoxazolecarboxylic acid, 4,5-dihydro-5,5-diphenyl-, ethyl ester
- 4,5-Dihydro-5,5-diphenyl-3-isoxazolecarboxylic acid ethyl ester
- Ae-F 122006
- Aef122006
- Ethyl 4,5-dihydro-5,5-diphenylisoxazol-3-carboxylate
- Ethyl 5,5-Diphenyl-4,5-Dihydroisoxazole-3-Carboxylate
- Ethyl5,5-diphenyl-2-isoxazoline-3-carboxylate
- Hoe 122006
- Isoxadifen ethyl ester
- Isoxadifen-Ethyl(Bsi,Pa Iso)
- See more synonyms
- Isoxadifen-ethyl
