CAS 16353-08-5

6-(Phenylmethyl)-4(3H)-pyrimidinone

Description:

6-(Phenylmethyl)-4(3H)-pyrimidinone, identified by its CAS number 16353-08-5, is a heterocyclic organic compound featuring a pyrimidinone core structure. This compound is characterized by the presence of a phenylmethyl group at the 6-position of the pyrimidinone ring, which contributes to its unique chemical properties and potential biological activities. The pyrimidinone moiety typically exhibits resonance stabilization due to the presence of the carbonyl group, influencing its reactivity and interactions with other molecules. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Additionally, the presence of the phenyl group can enhance lipophilicity, potentially affecting its bioavailability and interaction with biological targets. Overall, 6-(Phenylmethyl)-4(3H)-pyrimidinone serves as a valuable scaffold for further chemical modifications and investigations in the field of organic and medicinal chemistry.

Formula: C₁₁H₁₀N₂O

InChI: InChI=1S/C11H10N2O/c14-11-7-10(12-8-13-11)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,12,13,14)

InChI key: InChIKey=JCPZGLWRQNPRGS-UHFFFAOYSA-N

SMILES: C(C1=CC(=O)N=CN1)C2=CC=CC=C2

Synonyms:

• 4(3H)-Pyrimidinone, 6-(phenylmethyl)-
• 4(3H)-Pyrimidinone, 6-benzyl-
• 4(1H)-Pyrimidinone, 6-(phenylmethyl)-
• 6-(Phenylmethyl)-4(3H)-pyrimidinone
• 6-Benzyl-4-hydroxypyrimidine