CAS 163552-13-4
:3-iodovesamicol
Description:
3-Iodovesamicol is a chemical compound characterized by its unique structure, which includes an iodine atom attached to a vesamicol backbone. Vesamicol is known for its role as a selective antagonist of the vesicular acetylcholine transporter (VAChT), which is crucial for the storage of acetylcholine in synaptic vesicles. The introduction of the iodine atom in 3-iodovesamicol enhances its potential as a radiolabeled compound for imaging studies, particularly in positron emission tomography (PET) due to the radioactive properties of iodine isotopes. This compound exhibits lipophilicity, allowing it to cross biological membranes effectively, which is essential for its application in neuropharmacology. Additionally, 3-iodovesamicol's interactions with cholinergic systems make it a subject of interest in research related to neurodegenerative diseases and cognitive functions. Its synthesis and characterization involve standard organic chemistry techniques, and it is typically handled with caution due to the presence of iodine, which can be hazardous in certain forms.
Formula:C17H24INO
InChI:InChI=1/C17H24INO/c18-15-5-3-4-14(12-15)13-8-10-19(11-9-13)16-6-1-2-7-17(16)20/h3-5,12-13,16-17,20H,1-2,6-11H2
Synonyms:- trans-2-(4-(3-(Iodo-125I)phenyl)-1-piperidinyl)cyclohexanol
- Cyclohexanol, 2-(4-(3-(iodo-125I)phenyl)-1-piperidinyl)-, trans
- meta-Iodovesamicol
- (125I)Miv
- 3-Iodovesamicol
- 2-[4-(3-iodophenyl)piperidin-1-yl]cyclohexanol
- 2-(4-(3-(Iodo-125I)phenyl)piperidino)cyclohexanol
- m-Iodovesamicol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Iodovesamicol
CAS:<p>3-Iodovesamicol is a bioactive chemical.</p>Formula:C17H24INOColor and Shape:SolidMolecular weight:383.28
