CAS 16357-41-8

Ethyl 3-chloro-4-hydroxybenzoate

Description:

Ethyl 3-chloro-4-hydroxybenzoate, with the CAS number 16357-41-8, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, where a chlorine atom and a hydroxyl group are substituted on the aromatic ring. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many benzoate esters. Ethyl 3-chloro-4-hydroxybenzoate exhibits properties such as being a potential intermediate in organic synthesis and may have applications in pharmaceuticals or agrochemicals due to its functional groups. The presence of the chloro and hydroxy groups can impart unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and esterifications. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is of interest in both synthetic chemistry and potential applications in various fields.

Formula: C₉H₉ClO₃

InChI: InChI=1S/C9H9ClO3/c1-2-13-9(12)6-3-4-8(11)7(10)5-6/h3-5,11H,2H2,1H3

InChI key: InChIKey=QBOWIPYEPOVPGR-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC(Cl)=C(O)C=C1

Synonyms:

• 2-Chloro-4-ethoxycarbonyl phenol
• 3-Chloro-4-hydroxybenzoic acid ethyl ester
• Benzoic acid, 3-chloro-4-hydroxy-, ethyl ester
• Ethyl 3-Chloro-4-Hydroxybenzoate

Benzoic acid, 3-chloro-4-hydroxy-, ethyl ester

CAS: 16357-41-8

Formula: C₉H₉ClO₃

Purity: 95%

Molecular weight: 200.6190

Ref: IN-DA001U8S

Ethyl 3-chloro-4-hydroxybenzoate

CAS: 16357-41-8

Ethyl 3-chloro-4-hydroxybenzoate

Purity: 95%

Molecular weight: 200.62g/mol

Ref: 54-OR1052265

Ethyl 3-chloro-4-hydroxybenzoate

CAS: 16357-41-8

Purity: ≥95%

Molecular weight: 200.6199951

Ref: 10-F725257