CymitQuimica logo

CAS 163597-57-7

:

3-Cyano-4-isobutyloxythiobenzamide

Description:
3-Cyano-4-isobutyloxythiobenzamide is a chemical compound characterized by its unique functional groups and structural features. It contains a thiobenzamide core, which is a benzene ring substituted with a thiolamide group, and a cyano group (-CN) that enhances its reactivity and potential applications in organic synthesis. The isobutyloxy group introduces steric hindrance, influencing the compound's solubility and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of the cyano and thiolamide groups suggests potential for nucleophilic reactions, which can be exploited in various synthetic pathways. Safety data should be consulted for handling and storage, as compounds with similar structures may pose health risks. Overall, 3-Cyano-4-isobutyloxythiobenzamide represents a versatile structure in the realm of organic chemistry.
Formula:C12H14N2OS
InChI:InChI=1/C12H14N2OS/c1-8(2)7-15-11-4-3-9(12(14)16)5-10(11)6-13/h3-5,8H,7H2,1-2H3,(H2,14,16)
SMILES:CC(C)COc1ccc(cc1C#N)C(=N)S
Synonyms:
  • 3-Cyano-4-(2-methylpropoxy)benzenecarbothioamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.