CAS 1636134-70-7
:9-[(1-Oxohexadecyl)oxy]hexadecanoic acid
Description:
9-[(1-Oxohexadecyl)oxy]hexadecanoic acid, identified by its CAS number 1636134-70-7, is a fatty acid derivative characterized by a long hydrocarbon chain. This compound features a hexadecanoic acid backbone, which is a saturated fatty acid commonly known as palmitic acid, with an additional hexadecyl group linked through an ester bond. The presence of the oxo group indicates that there is a carbonyl functionality, which can influence the compound's reactivity and solubility. The structure suggests that it may exhibit amphiphilic properties, making it potentially useful in applications such as emulsifiers, surfactants, or in drug delivery systems. Its long hydrophobic tail contributes to its lipid-like characteristics, while the polar head group can interact with aqueous environments. Overall, this compound's unique structure may impart specific biological activities or functionalities, making it of interest in various fields, including biochemistry and materials science.
Formula:C32H62O4
InChI:InChI=1S/C32H62O4/c1-3-5-7-9-10-11-12-13-14-15-16-21-25-29-32(35)36-30(26-22-18-8-6-4-2)27-23-19-17-20-24-28-31(33)34/h30H,3-29H2,1-2H3,(H,33,34)
InChI key:InChIKey=DPFVDUJFYPYAOO-UHFFFAOYSA-N
SMILES:C(OC(CCCCCCCCCCCCCCC)=O)(CCCCCCCC(O)=O)CCCCCCC
Synonyms:- 9-[(1-Oxohexadecyl)oxy]hexadecanoic acid
- Hexadecanoic acid, 9-[(1-oxohexadecyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9-PAHPA
CAS:<p>9-PAHPA, a fatty acid ester of hydroxy fatty acid (FAHFA), belongs to a recently identified family of endogenous lipids known for their antidiabetic and anti-</p>Formula:C32H62O4Color and Shape:SolidMolecular weight:510.83
