CAS 1636134-73-0
:10-[(1-Oxohexadecyl)oxy]octadecanoic acid
Description:
10-[(1-Oxohexadecyl)oxy]octadecanoic acid, also known by its CAS number 1636134-73-0, is a fatty acid derivative characterized by a long hydrocarbon chain. This compound features a carboxylic acid functional group, which is typical of fatty acids, and an ether linkage due to the presence of the hexadecyl moiety. The structure indicates that it has both hydrophobic (the long hydrocarbon chains) and hydrophilic (the carboxylic acid group) properties, making it amphiphilic. This characteristic can influence its behavior in biological systems and its potential applications in emulsification, surfactants, or as a component in lipid-based formulations. The presence of the oxo group suggests that it may also participate in various chemical reactions, including esterification or oxidation. Overall, this compound's unique structure may confer specific physical and chemical properties, such as solubility in organic solvents and potential interactions with biological membranes, which could be of interest in fields like biochemistry, pharmacology, and materials science.
Formula:C34H66O4
InChI:InChI=1S/C34H66O4/c1-3-5-7-9-11-12-13-14-15-16-17-23-27-31-34(37)38-32(28-24-20-10-8-6-4-2)29-25-21-18-19-22-26-30-33(35)36/h32H,3-31H2,1-2H3,(H,35,36)
InChI key:InChIKey=UVHRDGWHIDFWID-UHFFFAOYSA-N
SMILES:C(OC(CCCCCCCCCCCCCCC)=O)(CCCCCCCCC(O)=O)CCCCCCCC
Synonyms:- 10-[(1-Oxohexadecyl)oxy]octadecanoic acid
- Octadecanoic acid, 10-[(1-oxohexadecyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
10-PAHSA
CAS:10-PAHSA is a FAHFA lipid where palmitic acid binds to 10-hydroxy stearic acid; abundant in AG4OX mice adipose tissue; may affect metabolism and inflammation.Formula:C34H66O4Color and Shape:SolidMolecular weight:538.89
