CymitQuimica logo

CAS 163622-50-2

:

5-Iodo-7H-pyrrolo[2,3-d]pyrimidin-4-amine

Description:
5-Iodo-7H-pyrrolo[2,3-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes both pyrrole and pyrimidine rings. The presence of an iodine atom at the 5-position contributes to its unique reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound typically exhibits properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. Its molecular structure allows for various functionalization possibilities, making it a valuable intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored in the context of drug discovery and development. The CAS number 163622-50-2 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, 5-Iodo-7H-pyrrolo[2,3-d]pyrimidin-4-amine is of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.
Formula:C6H5IN4
InChI:InChI=1S/C6H5IN4/c7-3-1-9-6-4(3)5(8)10-2-11-6/h1-2H,(H3,8,9,10,11)
InChI key:KLKWCKQHBCUTCL-UHFFFAOYSA-N
SMILES:C1=C(C2=C(N=CN=C2N1)N)I
Found 6 products.