
CAS 163622-52-4
:2-Amino-5-bromo-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one
Description:
2-Amino-5-bromo-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine moieties. This compound features an amino group and a bromine substituent, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its bromine atom may enhance its interaction with biological targets, while the amino group can participate in hydrogen bonding, influencing its pharmacokinetic properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-Amino-5-bromo-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one represents a valuable scaffold for further research in drug discovery and development.
Formula:C6H5BrN4O
InChI:InChI=1S/C6H5BrN4O/c7-2-1-9-4-3(2)5(12)11-6(8)10-4/h1H,(H4,8,9,10,11,12)
InChI key:InChIKey=NDMQSTLWRXVUIK-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(N)=N1)NC=C2Br
Synonyms:- 2-Amino-5-bromo-1H-pyrrolo[2,3-d]pyrimidin-4(7H)-one
- 2-Amino-5-bromo-1H,4H,7H-pyrrolo[2,3-d]pyrimidin-4-one
- 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 2-amino-5-bromo-3,7-dihydro-
- 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 2-amino-5-bromo-1,7-dihydro-
- 2-Amino-5-bromo-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.