CAS 163655-37-6
:MAZ51
Description:
MAZ51, with the CAS number 163655-37-6, is a chemical compound that has garnered attention in various fields, particularly in medicinal chemistry and pharmacology. It is characterized by its specific molecular structure, which contributes to its biological activity. MAZ51 is known to act as a selective inhibitor, targeting specific pathways or receptors, which makes it a subject of interest in drug development. The compound typically exhibits properties such as solubility in organic solvents, stability under standard laboratory conditions, and a defined melting point, although these specific physical properties can vary based on the formulation and purity. Its mechanism of action often involves modulation of cellular processes, which can lead to therapeutic effects in certain diseases. As with many chemical substances, safety and handling precautions are essential, as MAZ51 may have associated toxicity or require specific storage conditions to maintain its integrity. Overall, MAZ51 represents a significant compound in the ongoing exploration of new therapeutic agents.
Formula:C21H18N2O
InChI:InChI=1/C21H18N2O/c1-23(2)20-12-11-14(15-7-3-4-9-17(15)20)13-18-16-8-5-6-10-19(16)22-21(18)24/h3-13H,1-2H3,(H,22,24)/b18-13+
Synonyms:- 3-(4-Dimethylamino-Naphthalen-1-Ylmethylene)-1,3-Dihydro-Indol-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2H-Indol-2-one, 3-[[4-(dimethylamino)-1-naphthalenyl]methylene]-1,3-dihydro-
CAS:Formula:C21H18N2OPurity:98%Color and Shape:SolidMolecular weight:314.3804MAZ51
CAS:MAZ51 is a VEGFR-3 (Flt-4) tyrosine kinase inhibitor.Formula:C21H18N2OPurity:98.53%Color and Shape:SolidMolecular weight:314.38MAZ51
CAS:Controlled ProductApplications MAZ51 is an indolinone compound that selectively antagonizes the activation of VEGFR-3 by VEGF-C without blocking VEGF-C mediated stumulation of VEGFR-2. This reduces proliferation and induces apoptosis in various cancer cells and suppresses tumor growth.
References Kirkin, V. et al.: Eur. J. Biochem., 268, 5530 (2001);Formula:C21H18N2OColor and Shape:NeatMolecular weight:379.408



