CAS 163672-82-0

5-Amino-6-isoquinolinol

Description:

5-Amino-6-isoquinolinol is an organic compound characterized by its isoquinoline structure, which features a fused bicyclic system comprising a benzene ring and a pyridine ring. This compound contains an amino group (-NH2) and a hydroxyl group (-OH) attached to the isoquinoline framework, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of these functional groups enhances its reactivity and solubility in various solvents. 5-Amino-6-isoquinolinol may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds targeting specific biological pathways. Its molecular structure allows for various modifications, which can lead to derivatives with tailored properties. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and the presence of other chemical species. Overall, 5-Amino-6-isoquinolinol represents a significant compound in the realm of heterocyclic chemistry with potential applications in drug discovery and development.

Formula: C₉H₈N₂O

InChI: InChI=1S/C9H8N2O/c10-9-7-3-4-11-5-6(7)1-2-8(9)12/h1-5,12H,10H2

InChI key: InChIKey=WQJXZAOEPPCFLZ-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=CC1O)C=NC=C2

Synonyms:

• 6-Isoquinolinol, 5-amino-
• 5-Amino-6-isoquinolinol