CymitQuimica logo

CAS 163725-12-0

:

2-(2-cyanophenylthio)benzoic acid

Description:
2-(2-Cyanophenylthio)benzoic acid, identified by its CAS number 163725-12-0, is an organic compound characterized by the presence of both a benzoic acid moiety and a cyanophenylthio group. This compound features a thiol ether linkage, which contributes to its unique chemical properties. The presence of the cyanophenyl group introduces electron-withdrawing characteristics due to the cyano (-CN) functional group, which can influence the compound's reactivity and solubility. As a benzoic acid derivative, it exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The compound may also demonstrate potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its functional groups. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Overall, 2-(2-cyanophenylthio)benzoic acid is a versatile compound with distinct chemical characteristics that can be leveraged in various scientific fields.
Formula:C14H9NO2S
InChI:InChI=1/C14H9NO2S/c15-9-10-5-1-3-7-12(10)18-13-8-4-2-6-11(13)14(16)17/h1-8H,(H,16,17)
SMILES:c1ccc(c(c1)C#N)Sc1ccccc1C(=O)O
Synonyms:
  • 2-[(2-Cyanophenyl)Sulfanyl]Benzoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.