
CAS 1637310-58-7
:1,1-Dimethylethyl (4S)-2-bromo-4,6-dihydro-4-(1-methylethyl)-5H-pyrrolo[3,4-d]thiazole-5-carboxylate
Description:
1,1-Dimethylethyl (4S)-2-bromo-4,6-dihydro-4-(1-methylethyl)-5H-pyrrolo[3,4-d]thiazole-5-carboxylate, identified by its CAS number 1637310-58-7, is a chemical compound characterized by its complex structure, which includes a pyrrolo[3,4-d]thiazole core. This compound features a bromine atom and a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the dimethyl and isopropyl groups indicates steric hindrance, which may influence its chemical behavior and interactions with other molecules. The stereochemistry at the 4-position, denoted as (4S), suggests specific spatial arrangements that can affect the compound's biological activity and pharmacological properties. Such compounds are often of interest in medicinal chemistry and drug development due to their potential therapeutic effects. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research in various chemical and biological contexts.
Formula:C13H19BrN2O2S
InChI:InChI=1S/C13H19BrN2O2S/c1-7(2)10-9-8(19-11(14)15-9)6-16(10)12(17)18-13(3,4)5/h7,10H,6H2,1-5H3/t10-/m0/s1
InChI key:InChIKey=GNWLEKDKXLQJHA-JTQLQIEISA-N
SMILES:[C@H](C)(C)[C@H]1C2=C(CN1C(OC(C)(C)C)=O)SC(Br)=N2
Synonyms:- 1,1-Dimethylethyl (4S)-2-bromo-4,6-dihydro-4-(1-methylethyl)-5H-pyrrolo[3,4-d]thiazole-5-carboxylate
- 5H-Pyrrolo[3,4-d]thiazole-5-carboxylic acid, 2-bromo-4,6-dihydro-4-(1-methylethyl)-, 1,1-dimethylethyl ester, (4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.