CAS 1637310-66-7

4-Methoxy-4-methylcyclohexanemethanol

Description:

4-Methoxy-4-methylcyclohexanemethanol is an organic compound characterized by its cyclohexane structure, which features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the same carbon atom, along with a hydroxymethyl group (-CH2OH) at a different position on the cyclohexane ring. This compound is typically a colorless to pale yellow liquid with a pleasant odor, indicating its potential use in fragrance applications. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the hydroxymethyl group. The methoxy and methyl substituents contribute to its hydrophobic characteristics, while the hydroxymethyl group enhances its reactivity and potential for hydrogen bonding. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and esterifications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Methoxy-4-methylcyclohexanemethanol is of interest in both industrial and research contexts due to its unique structural features.

Formula: C₉H₁₈O₂

InChI: InChI=1S/C9H18O2/c1-9(11-2)5-3-8(7-10)4-6-9/h8,10H,3-7H2,1-2H3

InChI key: InChIKey=UKBJWLZFVUJOFJ-UHFFFAOYSA-N

SMILES: O(C)C1(C)CCC(CO)CC1

Synonyms:

• 4-Methoxy-4-methylcyclohexanemethanol
• (4-Methoxy-4-methylcyclohexyl)methanol
• Cyclohexanemethanol, 4-methoxy-4-methyl-