
CAS 1637310-75-8
:Ethyl tetrahydro-6-(trifluoromethyl)-2H-pyran-3-carboxylate
Description:
Ethyl tetrahydro-6-(trifluoromethyl)-2H-pyran-3-carboxylate is a chemical compound characterized by its unique structure, which includes a tetrahydropyran ring and a trifluoromethyl group. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is soluble in organic solvents like ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic characteristics. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity, making it a valuable intermediate in organic synthesis and pharmaceutical applications. Additionally, the compound may exhibit biological activity, which is often explored in medicinal chemistry. Safety data should be consulted for handling and storage, as compounds with trifluoromethyl groups can sometimes pose specific health and environmental risks. Overall, ethyl tetrahydro-6-(trifluoromethyl)-2H-pyran-3-carboxylate is a versatile compound with potential applications in various chemical fields.
Formula:C9H13F3O3
InChI:InChI=1S/C9H13F3O3/c1-2-14-8(13)6-3-4-7(15-5-6)9(10,11)12/h6-7H,2-5H2,1H3
InChI key:InChIKey=MUBVZXCAMNOVRS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CCC(C(F)(F)F)OC1
Synonyms:- Ethyl tetrahydro-6-(trifluoromethyl)-2H-pyran-3-carboxylate
- Ethyl 6-(trifluoromethyl)tetrahydro-2H-pyran-3-carboxylate
- 2H-Pyran-3-carboxylic acid, tetrahydro-6-(trifluoromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.