CAS 1637573-04-6: 1,2-Propanediol, 3-[4-[1-[4-[(2S)-2-(acetyloxy)-3-chloropropoxy]phenyl]-1-methylethyl]phenoxy]-, 1,2-diacetate, (2S)-

Description:1,2-Propanediol, 3-[4-[1-[4-[(2S)-2-(acetyloxy)-3-chloropropoxy]phenyl]-1-methylethyl]phenoxy]-, 1,2-diacetate, (2S)-, is a complex organic compound characterized by its multi-functional structure, which includes multiple phenyl groups and acetate functionalities. This compound is likely to exhibit properties typical of both diols and esters, such as solubility in polar solvents and potential reactivity with nucleophiles due to the presence of hydroxyl and ester groups. The presence of a chloropropoxy group suggests potential applications in medicinal chemistry or as an intermediate in organic synthesis. Its stereochemistry, indicated by the (2S) designation, implies specific spatial arrangements that may influence its biological activity and interactions. Additionally, the compound's molecular weight and specific functional groups may contribute to its physical properties, such as boiling point, melting point, and viscosity. Overall, this compound's intricate structure suggests a range of potential applications in pharmaceuticals, agrochemicals, or as a specialty chemical in various industrial processes.

Formula:C₂₇H₃₃ClO₈

InChI:InChI=1S/C27H33ClO8/c1-18(29)32-16-26(36-20(3)31)17-34-24-12-8-22(9-13-24)27(4,5)21-6-10-23(11-7-21)33-15-25(14-28)35-19(2)30/h6-13,25-26H,14-17H2,1-5H3/t25-,26-/m1/s1

InChI key:InChIKey=HGHVYYKTOXUQNT-CLJLJLNGSA-N

SMILES:O=C(OCC(OC(=O)C)COC1=CC=C(C=C1)C(C2=CC=C(OCC(OC(=O)C)CCl)C=C2)(C)C)C

Synonyms:
1,2-Propanediol, 3-[4-[1-[4-[(2S)-2-(acetyloxy)-3-chloropropoxy]phenyl]-1-methylethyl]phenoxy]-, 1,2-diacetate, (2S)-
EPI 506

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Ralaniten triacetate REF: 54-BUP12055CAS: 1637573-04-6	99.37%	1,917.00 €~5,775.00 €	Mon 21 Apr 25
Ralaniten acetate REF: 3D-MQC57304CAS: 1637573-04-6	Min. 95%	To inquire	Tue 03 Jun 25
Ralaniten triacetate REF: TM-T36375CAS: 1637573-04-6	99.37%	162.00 €~2,375.00 €	Tue 10 Jun 25