CAS 16378-06-6
:3-THIEN-3-YLPROPANOIC ACID
Description:
3-Thien-3-ylpropanoic acid, identified by its CAS number 16378-06-6, is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a propanoic acid functional group, indicating that it possesses both a carboxylic acid (-COOH) and a side chain derived from a thiophene. The thiophene moiety contributes to the compound's aromaticity and potential for various chemical interactions, including electrophilic substitution reactions. 3-Thien-3-ylpropanoic acid is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while its thiophene structure may enhance lipophilicity. The compound may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, owing to its unique structural features. Additionally, its properties can be influenced by factors such as pH, temperature, and the presence of other functional groups in a given reaction environment.
Formula:C7H7O2S
InChI:InChI=1/C7H8O2S/c8-7(9)2-1-6-3-4-10-5-6/h3-5H,1-2H2,(H,8,9)/p-1
SMILES:C(CC(=O)[O-])c1ccsc1
Synonyms:- 3-(3-Thienyl)propanoic acid
- 3-Thiophenepropanoic Acid
- 3-(Thiophen-3-Yl)Propanoic Acid
- 3-Thiophen-3-Ylpropanoate
- 3-thien-3-ylpropanoic acid
- 3-(Thiophen-3-yl)
- 3-thien-3-yipropanoic acid
- 3-(3-thienyl)propanoic acid 0.2H2O
- 3-thien-3-yipro
- 3-(3-Thiophene)propanoic acid
- 3-(3-thienyl)propanoic acid(SALTDATA: 0.2H2O)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Thiophenepropanoic acid
CAS:Formula:C7H8O2SPurity:97%Color and Shape:SolidMolecular weight:156.20223-(3-Thienyl)propanoic acid
CAS:3-(3-Thienyl)propanoic acid is a protonated form of 3-thienylacetic acid that is prepared by electropolymerization. This compound is a dipole with an enthalpic interaction, which has been shown to be thermodynamically favorable. The protonation of the 3-(3-thienyl)propanoic acid molecule takes place at the perovskite surface and leads to an exothermic reaction.Formula:C7H8O2SPurity:Min. 95%Molecular weight:156.2 g/mol



