CAS 1638-26-2
:1,1-Dimethylcyclopentane
Description:
1,1-Dimethylcyclopentane is a cyclic hydrocarbon with the molecular formula C7H14. It features a cyclopentane ring with two methyl groups attached to the same carbon atom, specifically at the 1-position, which contributes to its unique structural characteristics. This compound is a colorless liquid at room temperature and exhibits a relatively low boiling point compared to larger hydrocarbons. It is non-polar and hydrophobic, making it insoluble in water but soluble in organic solvents. The presence of the two methyl groups introduces steric strain and influences its reactivity, making it less reactive than other alkenes or alkynes. 1,1-Dimethylcyclopentane is primarily used in organic synthesis and as a solvent in various chemical reactions. Its physical properties, such as density and viscosity, are influenced by the arrangement of its atoms and the presence of the cyclopentane ring, which can affect its behavior in different chemical environments. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H14
InChI:InChI=1S/C7H14/c1-7(2)5-3-4-6-7/h3-6H2,1-2H3
InChI key:InChIKey=QWHNJUXXYKPLQM-UHFFFAOYSA-N
SMILES:CC1(C)CCCC1
Synonyms:- 1,1-Dimethylcycopentane
- Cyclopentane, 1,1-dimethyl-
- Cyclopentane, 1,1-dimethyl- (8CI)(9CI)
- Nsc 74145
- gem-Dimethylcyclopentane
- 1,1-Dimethylcyclopentane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,1-Dimethylcyclopentane
CAS:Controlled ProductFormula:C7H14Color and Shape:NeatMolecular weight:98.19
