CAS 163808-13-7

4-Nitrobenzoxazole

Description:

4-Nitrobenzoxazole is an organic compound characterized by its heterocyclic structure, which includes a benzene ring fused to an oxazole ring, with a nitro group (-NO2) positioned at the 4-position of the benzene ring. This compound typically appears as a yellow to orange crystalline solid and is known for its potential applications in various fields, including materials science and organic electronics. It exhibits notable fluorescence properties, making it useful in fluorescence microscopy and as a fluorescent probe in biochemical assays. The presence of the nitro group contributes to its electronic properties, influencing its reactivity and stability. 4-Nitrobenzoxazole is generally soluble in organic solvents, but its solubility in water is limited. As with many nitro-containing compounds, it may pose certain health and environmental risks, necessitating careful handling and disposal. Overall, 4-Nitrobenzoxazole is a valuable compound in research and industrial applications due to its unique chemical properties.

Formula: C₇H₄N₂O₃

InChI: InChI=1S/C7H4N2O3/c10-9(11)5-2-1-3-6-7(5)8-4-12-6/h1-4H

InChI key: InChIKey=SLXGGFDKGANNSL-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(OC=N2)=CC=C1

Synonyms:

• 4-Nitrobenzoxazole
• Benzoxazole, 4-nitro-

4-Nitro-1,3-benzoxazole

CAS: 163808-13-7

Formula: C₇H₄N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.1183

Ref: IN-DA00AQK3

4-Nitro-1,3-benzoxazole

CAS: 163808-13-7

4-Nitro-1,3-benzoxazole

Formula: C₇H₄N₂O₃

Purity: ≥95%

Color and Shape: brown purple solid

Molecular weight: 164.12g/mol

Ref: 54-OR400059

4-NITRO-1,3-BENZOXAZOLE

CAS: 163808-13-7

Formula: C₇H₄N₂O₃

Purity: 98%

Molecular weight: 164.12

Ref: 10-F542326