CymitQuimica logo

CAS 16381-46-7

:

5-Fluoro-3-methyl-1H-indole-2-carboxylic acid

Description:
5-Fluoro-3-methyl-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position and a methyl group at the 3-position of the indole ring contributes to its unique properties. The carboxylic acid functional group at the 2-position enhances its acidity and solubility in polar solvents. This compound is often studied for its potential biological activities, including its role in medicinal chemistry and as a building block in the synthesis of various pharmaceuticals. Its molecular structure allows for interactions with biological targets, making it of interest in drug development. Additionally, the presence of the fluorine atom can influence the compound's lipophilicity and metabolic stability, which are critical factors in pharmacokinetics. Overall, 5-Fluoro-3-methyl-1H-indole-2-carboxylic acid is a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c1-5-7-4-6(11)2-3-8(7)12-9(5)10(13)14/h2-4,12H,1H3,(H,13,14)
InChI key:InChIKey=XNWVWEWWPNKNJX-UHFFFAOYSA-N
SMILES:CC=1C=2C(NC1C(O)=O)=CC=C(F)C2
Synonyms:
  • 1H-indole-2-carboxylic acid, 5-fluoro-3-methyl-
  • Indole-2-carboxylic acid, 5-fluoro-3-methyl-
  • 5-Fluoro-3-methyl-1H-indole-2-carboxylic acid
Found 3 products.