CAS 16381-47-8
:5-chloro-3-methyl-1H-indole-2-carboxylic acid
Description:
5-Chloro-3-methyl-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 5-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound features a carboxylic acid functional group at the 2-position, which imparts acidic characteristics and enhances its solubility in polar solvents. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential biological activities and applications in drug development. Its reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating properties of the methyl group, making it a versatile building block for further chemical synthesis. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H8ClNO2
InChI:InChI=1/C10H8ClNO2/c1-5-7-4-6(11)2-3-8(7)12-9(5)10(13)14/h2-4,12H,1H3,(H,13,14)
SMILES:Cc1c2cc(ccc2[nH]c1C(=O)O)Cl
Synonyms:- 1H-indole-2-carboxylic acid, 5-chloro-3-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Indole-2-carboxylic acid, 5-chloro-3-methyl-
CAS:Formula:C10H8ClNO2Purity:97%Color and Shape:SolidMolecular weight:209.62905-Chloro-3-methyl-1H-indole-2-carboxylic acid
CAS:5-Chloro-3-methyl-1H-indole-2-carboxylic acidPurity:98%Molecular weight:209.63g/mol5-Chloro-3-methyl-1H-indole-2-carboxylic acid
CAS:<p>5-Chloro-3-methyl-1H-indole-2-carboxylic acid (5CMC) is a versatile building block and research chemical. It has been shown to be an effective intermediate for the synthesis of many complex compounds with interesting pharmacological properties. 5CMC is also used as a speciality chemical in the production of pharmaceuticals, agrochemicals, and other chemicals. The compound is a fine chemical that can be used in various research and industrial applications.</p>Formula:C10H8ClNO2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:209.63 g/mol5-Chloro-3-methyl-1H-indole-2-carboxylic acid
CAS:Formula:C10H8ClNO2Purity:98%Color and Shape:SolidMolecular weight:209.63



