CAS 1638221-28-9

Acetamide, 2-bromo-N-(2-pyridinylmethyl)-, hydrochloride (1:1)

Description:

Acetamide, 2-bromo-N-(2-pyridinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its acetamide functional group and the presence of a bromine atom at the 2-position of the acetamide structure. The compound features a pyridinylmethyl substituent, which contributes to its potential biological activity and solubility properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the pyridine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit specific reactivity patterns, influenced by the bromine atom and the nitrogen in the pyridine ring. Overall, this compound's characteristics, including its solubility, reactivity, and potential biological activity, make it a subject of interest in research and development within the fields of organic and medicinal chemistry.

Formula: C₈H₉BrN₂O·ClH

InChI: InChI=1S/C8H9BrN2O.ClH/c9-5-8(12)11-6-7-3-1-2-4-10-7;/h1-4H,5-6H2,(H,11,12);1H

InChI key: InChIKey=JDKZNGUOICYEDJ-UHFFFAOYSA-N

SMILES: C(NC(CBr)=O)C1=CC=CC=N1.Cl

Synonyms:

• Acetamide, 2-bromo-N-(2-pyridinylmethyl)-, hydrochloride (1:1)