CAS 163854-63-5
:4-Iodo-1-tosyl-1H-imidazole
Description:
4-Iodo-1-tosyl-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the iodo group at the 4-position introduces significant reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The tosyl group, derived from toluenesulfonic acid, enhances the compound's electrophilicity and solubility in organic solvents, facilitating nucleophilic substitution reactions. This compound is typically used as an intermediate in the synthesis of pharmaceuticals and other biologically active molecules. Its molecular structure contributes to its stability under standard conditions, although it may be sensitive to light and moisture. Additionally, the compound's properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used in experiments. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C10H9IN2O2S
InChI:InChI=1/C10H9IN2O2S/c1-8-2-4-9(5-3-8)16(14,15)13-6-10(11)12-7-13/h2-7H,1H3
SMILES:Cc1ccc(cc1)S(=O)(=O)n1cc(I)nc1
Synonyms:- 4-iodo-1-[(4-methylphenyl)sulfonyl]-1H-Imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
