CAS 1638603-93-6

(3S)-6-Chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine-3-propanol

Description:

(3S)-6-Chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine-3-propanol is a chemical compound characterized by its complex bicyclic structure, which includes a pyridine and pyrazine moiety. The presence of a chlorine atom at the 6-position contributes to its reactivity and potential biological activity. The compound features a hydroxyl group (-OH) at the 3-position, which can participate in hydrogen bonding and influence its solubility and interaction with biological targets. Its stereochemistry, indicated by the (3S) designation, suggests specific spatial arrangements that may affect its pharmacological properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Additionally, its unique structural features may allow for specific interactions with enzymes or receptors, potentially leading to therapeutic applications. As with many chemical substances, its stability, reactivity, and interactions with other compounds would depend on environmental conditions such as pH, temperature, and solvent.

Formula: C₁₀H₁₄ClN₃O

InChI: InChI=1S/C10H14ClN3O/c11-9-4-3-8-10(14-9)13-7(6-12-8)2-1-5-15/h3-4,7,12,15H,1-2,5-6H2,(H,13,14)/t7-/m0/s1

InChI key: InChIKey=YJXUQTADKAYUEA-ZETCQYMHSA-N

SMILES: C(CCO)[C@@H]1NC=2C(NC1)=CC=C(Cl)N2

Synonyms:

• Pyrido[2,3-b]pyrazine-3-propanol, 6-chloro-1,2,3,4-tetrahydro-, (3S)-
• 3-[(3S)-6-Chloro-1H,2H,3H,4H-pyrido[2,3-b]pyrazin-3-yl]propan-1-ol
• (3S)-6-Chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine-3-propanol