
CAS 1638612-50-6
:Methyl 1,3,4,6-tetrahydro-8-methoxy-6-oxo-2H-quinolizine-9-carboxylate
Description:
Methyl 1,3,4,6-tetrahydro-8-methoxy-6-oxo-2H-quinolizine-9-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a quinolizine core. This compound features multiple functional groups, including a methoxy group and a carboxylate ester, contributing to its potential reactivity and solubility properties. The presence of the carbonyl group (6-oxo) suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The tetrahydro configuration indicates that the compound is saturated in certain positions, which may influence its biological activity and stability. Compounds of this type are often studied for their pharmacological properties, as they may exhibit activities such as antimicrobial, anti-inflammatory, or anticancer effects. The specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise values, but the structural features suggest a compound with potential applications in medicinal chemistry and drug development.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c1-16-9-7-10(14)13-6-4-3-5-8(13)11(9)12(15)17-2/h7H,3-6H2,1-2H3
InChI key:InChIKey=XMIKMBRKZMZHSN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2N(C(=O)C=C1OC)CCCC2
Synonyms:- Methyl 1,3,4,6-tetrahydro-8-methoxy-6-oxo-2H-quinolizine-9-carboxylate
- 2H-Quinolizine-9-carboxylic acid, 1,3,4,6-tetrahydro-8-methoxy-6-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.