CAS 1638612-57-3

1,2,4-Oxadiazole, 3-(1-methyl-1H-pyrrol-2-yl)-5-(3-pyrrolidinyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole, 3-(1-methyl-1H-pyrrol-2-yl)-5-(3-pyrrolidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the pyrrol-2-yl and pyrrolidinyl substituents indicates that the compound has potential biological activity, as these moieties are often associated with pharmacological properties. The hydrochloride form suggests that the compound is a salt, which can enhance its solubility and stability in aqueous solutions. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or analgesic effects, typical of many nitrogen-containing heterocycles. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. However, specific data regarding its physical properties, such as melting point, solubility, and spectral characteristics, would require experimental determination or literature reference for precise values.

Formula: C₁₁H₁₄N₄O·ClH

InChI: InChI=1S/C11H14N4O.ClH/c1-15-6-2-3-9(15)10-13-11(16-14-10)8-4-5-12-7-8;/h2-3,6,8,12H,4-5,7H2,1H3;1H

InChI key: InChIKey=WPENNQICKDUTEA-UHFFFAOYSA-N

SMILES: CN1C(=CC=C1)C=2N=C(ON2)C3CCNC3.Cl

Synonyms:

• 1,2,4-Oxadiazole, 3-(1-methyl-1H-pyrrol-2-yl)-5-(3-pyrrolidinyl)-, hydrochloride (1:1)