CAS 1638696-02-2

2-(4-Morpholinyl)-5-benzothiazolecarboxylic acid

Description:

2-(4-Morpholinyl)-5-benzothiazolecarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a morpholine ring. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of the carboxylic acid functional group. The morpholine ring contributes to its potential as a pharmacophore, enhancing its biological activity and interaction with various biological targets. The compound may display acidic properties due to the carboxylic acid group, allowing it to participate in acid-base reactions. Additionally, its benzothiazole component may impart fluorescence or other electronic properties, making it of interest in various applications, including pharmaceuticals and materials science. The presence of both heteroatoms (nitrogen and sulfur) in its structure can also influence its reactivity and stability. Overall, 2-(4-Morpholinyl)-5-benzothiazolecarboxylic acid is a compound of interest for further research in medicinal chemistry and related fields.

Formula: C₁₂H₁₂N₂O₃S

InChI: InChI=1S/C12H12N2O3S/c15-11(16)8-1-2-10-9(7-8)13-12(18-10)14-3-5-17-6-4-14/h1-2,7H,3-6H2,(H,15,16)

InChI key: InChIKey=XPJQQBUMXVKPNL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(SC(=N2)N3CCOCC3)=CC1

Synonyms:

• 2-(Morpholin-4-yl)-1,3-benzothiazole-5-carboxylic acid
• 5-Benzothiazolecarboxylic acid, 2-(4-morpholinyl)-
• 2-(4-Morpholinyl)-5-benzothiazolecarboxylic acid
• 2-Morpholin-4-yl-benzothiazole-5-carboxylic acid

2-Morpholinobenzo[d]thiazole-5-carboxylic acid

CAS: 1638696-02-2

2-Morpholinobenzo[d]thiazole-5-carboxylic acid

Purity: ≥95%

Molecular weight: 264.30g/mol

Ref: 54-OR300262