CAS 1638743-93-7
:(4S)-4-Amino-3,3-dimethyl-2-pyrrolidinone
Description:
(4S)-4-Amino-3,3-dimethyl-2-pyrrolidinone is a chemical compound characterized by its unique pyrrolidinone structure, which features a five-membered ring containing both nitrogen and carbon atoms. The presence of an amino group at the 4-position and two methyl groups at the 3-position contributes to its basicity and steric properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which is indicative of its potential for hydrogen bonding due to the amino and carbonyl functionalities. Its chirality, denoted by the (4S) configuration, suggests that it may exhibit specific biological activity or interact with biological systems in a stereoselective manner. The compound may be of interest in pharmaceutical applications, particularly in the development of drugs targeting specific receptors or enzymes. Additionally, its structural features may influence its reactivity and stability, making it a subject of study in synthetic organic chemistry and medicinal chemistry.
Formula:C6H12N2O
InChI:InChI=1S/C6H12N2O/c1-6(2)4(7)3-8-5(6)9/h4H,3,7H2,1-2H3,(H,8,9)/t4-/m1/s1
InChI key:InChIKey=SDMORDSHKGMDJC-SCSAIBSYSA-N
SMILES:CC1(C)[C@H](N)CNC1=O
Synonyms:- 2-Pyrrolidinone, 4-amino-3,3-dimethyl-, (4S)-
- (4S)-4-Amino-3,3-dimethyl-2-pyrrolidinone
- (4S)-4-Amino-3,3-dimethylpyrrolidin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
