CAS 1638744-13-4: 1,1-Dimethylethyl (2R,3S)-3-hydroxy-2-methyl-1-azetidinecarboxylate

Description:1,1-Dimethylethyl (2R,3S)-3-hydroxy-2-methyl-1-azetidinecarboxylate, identified by its CAS number 1638744-13-4, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. The compound features a carboxylate functional group, indicating it is a derivative of a carboxylic acid, and it possesses a hydroxyl group, contributing to its potential as a chiral molecule. The presence of the dimethyl group suggests steric hindrance, which can influence its reactivity and interactions with other molecules. The specific stereochemistry denoted by (2R,3S) indicates the spatial arrangement of atoms around the chiral centers, which is crucial for its biological activity and potential applications in pharmaceuticals. This compound may exhibit interesting properties such as solubility in polar solvents and the ability to participate in hydrogen bonding due to the hydroxyl group. Overall, its unique structural features make it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula:C₉H₁₇NO₃

InChI:InChI=1S/C9H17NO3/c1-6-7(11)5-10(6)8(12)13-9(2,3)4/h6-7,11H,5H2,1-4H3/t6-,7+/m1/s1

InChI key:InChIKey=OBLFUJCDADLZAJ-RQJHMYQMSA-N

SMILES:O=C(OC(C)(C)C)N1CC(O)C1C

Synonyms:
1,1-Dimethylethyl (2R,3S)-3-hydroxy-2-methyl-1-azetidinecarboxylate
1-Azetidinecarboxylic acid, 3-hydroxy-2-methyl-, 1,1-dimethylethyl ester, (2R,3S)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
TERT-BUTYL (2R,3S)-3-HYDROXY-2-METHYLAZETIDINE-1-CARBOXYLATE REF: 10-F824760CAS: 1638744-13-4	95%	95.00 €~1,532.00 €	Mon 31 Mar 25
tert-butyl-3-hydroxy-2-methylazetidine-1-carboxylate, trans- REF: 10-F517338CAS: 1638744-13-4	95	- - -	Discontinued product
(2R,3S)-1-Boc-3-hydroxy-2-methylazetidine REF: 3D-NQC74413CAS: 1638744-13-4	Min. 95%	- - -	Discontinued product