CAS 1638744-82-7

Piperidine, 3-(difluoromethoxy)-, hydrochloride (1:1), (3R)-

Description:

Piperidine, 3-(difluoromethoxy)-, hydrochloride (1:1), (3R)- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a difluoromethoxy group at the 3-position of the piperidine ring imparts unique electronic and steric properties, influencing its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and chemical research. The (3R)- designation indicates the specific stereochemistry at the chiral center, which can significantly affect the compound's pharmacological properties. This compound may exhibit interesting interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 1638744-82-7, allows for precise identification in chemical databases and literature. Overall, the characteristics of this compound suggest potential applications in drug development and synthesis, although specific biological activities and safety profiles would require further investigation.

Formula: C₆H₁₁F₂NO·ClH

InChI: InChI=1S/C6H11F2NO.ClH/c7-6(8)10-5-2-1-3-9-4-5;/h5-6,9H,1-4H2;1H/t5-;/m1./s1

InChI key: InChIKey=TWRUORSJHMYXSK-NUBCRITNSA-N

SMILES: O(C(F)F)[C@@H]1CCCNC1.Cl

Synonyms:

• Piperidine, 3-(difluoromethoxy)-, hydrochloride (1:1), (3R)-

(3R)-3-(difluoromethoxy)piperidinehydrochloride

CAS: 1638744-82-7

Formula: C₆H₁₂ClF₂NO

Purity: 97%

Molecular weight: 187.6154

Ref: IN-DA01JUXM

(3R)-3-(Difluoromethoxy)piperidine hydrochloride

CAS: 1638744-82-7

Purity: 97%

Molecular weight: 187.6100006

Ref: 10-F625192