CAS 1638759-69-9

Methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate

Description:

Methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a pyridine and a pyrrole ring. The presence of a chlorine atom at the 5-position and a methoxycarbonyl group (methyl ester) at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic nature. It may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it of interest in synthetic organic chemistry. The compound's potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine derivatives. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate represents a valuable structure for further research and development in chemical synthesis and drug discovery.

Formula: C₉H₇ClN₂O₂

InChI: InChI=1S/C9H7ClN2O2/c1-14-9(13)6-2-5-3-8(10)11-4-7(5)12-6/h2-4,12H,1H3

InChI key: InChIKey=WNKGCGSPLKWAHD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1NC=2C(C1)=CC(Cl)=NC2

Synonyms:

• Methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate
• 1H-Pyrrolo[2,3-c]pyridine-2-carboxylic acid, 5-chloro-, methyl ester

Methyl 5-chloro-1H-pyrrolo[2,3-c]pyridine-2-carboxylate

CAS: 1638759-69-9

Purity: 98%

Molecular weight: 210.6199951

Ref: 10-F625563