CAS 1638759-81-5

Cyclobutanamine, 3-(4-fluoro-3-methoxyphenoxy)-, hydrochloride (1:1), trans-

Description:

Cyclobutanamine, 3-(4-fluoro-3-methoxyphenoxy)-, hydrochloride (1:1), trans- is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a phenoxy group substituted with a fluorine atom and a methoxy group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the fluorine atom often contributes to increased metabolic stability and lipophilicity, while the methoxy group can affect the compound's electronic properties and reactivity. The trans configuration indicates a specific spatial arrangement of substituents around the cyclobutane ring, which can be crucial for its biological activity. As with many compounds in medicinal chemistry, the specific interactions of this substance with biological targets would depend on its three-dimensional conformation and the functional groups present. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents.

Formula: C₁₁H₁₄FNO₂·ClH

InChI: InChI=1/C11H14FNO2.ClH/c1-14-11-6-8(2-3-10(11)12)15-9-4-7(13)5-9;/h2-3,6-7,9H,4-5,13H2,1H3;1H/t7-,9-;

InChI key: InChIKey=JJJLNTVPLOLXHC-FJAZHTGZNA-N

SMILES: O(C1=CC(OC)=C(F)C=C1)[C@H]2C[C@H](N)C2.Cl

Synonyms:

• Cyclobutanamine, 3-(4-fluoro-3-methoxyphenoxy)-, hydrochloride (1:1), trans-