CAS 1638759-82-6

Methyl 2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate

Description:

Methyl 2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrrolo-pyrimidine framework. This compound features a methylthio group, which contributes to its unique chemical properties and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the carboxylate functional group suggests that it may participate in various chemical reactions, including esterification and nucleophilic substitutions. This compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. As with many heterocycles, it may also display distinct spectral characteristics in techniques such as NMR and mass spectrometry, aiding in its identification and characterization in research settings.

Formula: C₉H₉N₃O₂S

InChI: InChI=1S/C9H9N3O2S/c1-14-8(13)6-3-5-4-10-9(15-2)12-7(5)11-6/h3-4H,1-2H3,(H,10,11,12)

InChI key: InChIKey=QTGIXKBBHDUTGS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1NC=2C(C1)=CN=C(SC)N2

Synonyms:

• 7H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 2-(methylthio)-, methyl ester
• Methyl 2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylate

Trilaciclib Impurity 1

CAS: 1638759-82-6

Formula: C₉H₉N₃O₂S

Molecular weight: 223.25

Ref: 4Z-T-474005