CAS 1638760-07-2

3-Fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)-3-pyridinyl]benzenamine

Description:

3-Fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)-3-pyridinyl]benzenamine is a chemical compound characterized by its complex structure, which includes a fluorobenzene moiety and a pyridine ring substituted with a tetrazole group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its biological activity. The tetrazole group, known for its ability to form hydrogen bonds and participate in various chemical reactions, may contribute to the compound's pharmacological properties. This compound is likely to exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in areas such as oncology or infectious diseases, where similar compounds have shown efficacy. Additionally, the presence of multiple heteroatoms (like nitrogen in the tetrazole and pyridine) may affect its solubility and stability in various environments. Overall, this compound represents a class of molecules that could be valuable in pharmaceutical research and development.

Formula: C₁₃H₁₁FN₆

InChI: InChI=1S/C13H11FN6/c1-20-18-13(17-19-20)12-5-2-8(7-16-12)10-4-3-9(15)6-11(10)14/h2-7H,15H2,1H3

InChI key: InChIKey=DPAOGFLEXIXQBT-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(N)=C1)C=2C=CC(=NC2)C3=NN(C)N=N3

Synonyms:

• 3-Fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)-3-pyridinyl]benzenamine
• Benzenamine, 3-fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)-3-pyridinyl]-