CymitQuimica logo

CAS 1638760-18-5

:

6-Methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine

Description:
6-Methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 6-position and an amino group at the 2-position of the pyrimidine ring, enhancing its potential for biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular framework allows for various functionalizations, which can lead to derivatives with altered properties. As with many heterocycles, it may exhibit interesting electronic properties, including potential for π-π stacking interactions and hydrogen bonding, which are significant in drug design and molecular recognition processes. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c1-4-2-5-3-9-7(8)11-6(5)10-4/h2-3H,1H3,(H3,8,9,10,11)
InChI key:InChIKey=GOCNRYDZTVESBF-UHFFFAOYSA-N
SMILES:CC1=CC=2C(N1)=NC(N)=NC2
Synonyms:
  • 6-Methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine
  • 7H-Pyrrolo[2,3-d]pyrimidin-2-amine, 6-methyl-
Found 1 products.