CAS 1638760-54-9

6-Amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:

6-Amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it a potential candidate for various biochemical applications, including as a building block in drug synthesis or as a ligand in coordination chemistry. The presence of these functional groups enhances its solubility in polar solvents and allows for potential interactions with biological targets. Additionally, the specific arrangement of atoms within the pyrrolo[2,3-b]pyridine framework may impart interesting electronic properties, which can influence its reactivity and stability. The compound's molecular structure suggests it could participate in hydrogen bonding, further affecting its physical properties and interactions in biological systems. Overall, 6-Amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and materials science.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c9-6-2-1-4-5(8(12)13)3-10-7(4)11-6/h1-3H,(H,12,13)(H3,9,10,11)

InChI key: InChIKey=HFUNZILRLQQTGO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=NC(N)=CC2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 6-amino-
• 6-Amino-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid