
CAS 1638760-61-8
:1,1-Dimethylethyl hexahydro-2-oxopyrrolo[3,4-b]pyrrole-5(1H)-carboxylate
Description:
1,1-Dimethylethyl hexahydro-2-oxopyrrolo[3,4-b]pyrrole-5(1H)-carboxylate, identified by its CAS number 1638760-61-8, is a chemical compound that belongs to a class of heterocyclic compounds. It features a complex structure characterized by a pyrrole ring fused with a pyrrolidine moiety, which contributes to its unique chemical properties. The presence of a carboxylate group indicates potential for reactivity, particularly in esterification or amidation reactions. The dimethyl substituents on the ethyl group suggest steric hindrance, which may influence its reactivity and interactions with other molecules. This compound may exhibit interesting biological activities, making it a candidate for pharmaceutical applications. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks or environmental hazards. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C11H18N2O3
InChI:InChI=1S/C11H18N2O3/c1-11(2,3)16-10(15)13-5-7-4-9(14)12-8(7)6-13/h7-8H,4-6H2,1-3H3,(H,12,14)
InChI key:InChIKey=DUDMFDUPLWUUBV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2C(C1)NC(=O)C2
Synonyms:- Pyrrolo[3,4-b]pyrrole-5(1H)-carboxylic acid, hexahydro-2-oxo-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl hexahydro-2-oxopyrrolo[3,4-b]pyrrole-5(1H)-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.