CAS 1638760-73-2

Methyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate

Description:

Methyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both pyrrole and pyridine rings. This compound features a chlorine atom at the 5-position of the pyrrole ring and a methoxycarbonyl group at the 3-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the chlorine substituent can influence the compound's electronic properties and solubility, while the ester functional group may participate in various chemical reactions, such as hydrolysis or transesterification. Methyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate is of interest in the development of pharmaceuticals, particularly in the synthesis of biologically active molecules. Its unique structural features may also allow for interactions with biological targets, making it a candidate for further research in drug discovery and development. As with many heterocycles, the compound's stability, reactivity, and potential toxicity should be evaluated in the context of its intended applications.

Formula: C₉H₇ClN₂O₂

InChI: InChI=1S/C9H7ClN2O2/c1-14-9(13)5-4-11-6-2-3-7(10)12-8(5)6/h2-4,11H,1H3

InChI key: InChIKey=XHZWHSBXYRHMLH-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(NC1)=CC=C(Cl)N2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid, 5-chloro-, methyl ester
• Methyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate

Methyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate

CAS: 1638760-73-2

Methyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate

Purity: 98%

Molecular weight: 210.62g/mol

Ref: 54-OR1060734

Methyl 5-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate

CAS: 1638760-73-2

Purity: 98%

Molecular weight: 210.6199951

Ref: 10-F625674