
CAS 1638761-35-9
:4,7-Diazaspiro[2.5]octan-6-one, hydrochloride (1:1)
Description:
4,7-Diazaspiro[2.5]octan-6-one, hydrochloride (1:1) is a chemical compound characterized by its spirocyclic structure, which features a bicyclic framework containing two nitrogen atoms in the ring system. This compound is typically classified as a heterocyclic amine due to the presence of nitrogen atoms. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. The presence of the carbonyl group (ketone) contributes to its reactivity and potential biological activity. Compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The specific arrangement of atoms and functional groups in 4,7-Diazaspiro[2.5]octan-6-one suggests potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, and further studies are often required to fully understand its properties and applications.
Formula:C6H10N2O·ClH
InChI:InChI=1S/C6H10N2O.ClH/c9-5-3-8-6(1-2-6)4-7-5;/h8H,1-4H2,(H,7,9);1H
InChI key:InChIKey=VIKPUNNKDJKOAQ-UHFFFAOYSA-N
SMILES:O=C1NCC2(CC2)NC1.Cl
Synonyms:- 4,7-Diazaspiro[2.5]octan-6-one, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.