CAS 1638763-65-1

1,3-Dihydro-4-nitro-2H-pyrrolo[2,3-b]pyridin-2-one

Description:

1,3-Dihydro-4-nitro-2H-pyrrolo[2,3-b]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features a nitro group at the 4-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the carbonyl group in the pyrrolidine ring enhances its ability to participate in various chemical reactions, such as nucleophilic attacks. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to its functional groups. Its molecular structure suggests potential biological activity, making it a candidate for further research in drug development. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, 1,3-Dihydro-4-nitro-2H-pyrrolo[2,3-b]pyridin-2-one represents a class of compounds that may hold significance in synthetic organic chemistry and pharmacology.

Formula: C₇H₅N₃O₃

InChI: InChI=1S/C7H5N3O3/c11-6-3-4-5(10(12)13)1-2-8-7(4)9-6/h1-2H,3H2,(H,8,9,11)

InChI key: InChIKey=WTLDHOARMFFBIQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(NC(=O)C2)=NC=C1

Synonyms:

• 1,3-Dihydro-4-nitro-2H-pyrrolo[2,3-b]pyridin-2-one
• 2H-Pyrrolo[2,3-b]pyridin-2-one, 1,3-dihydro-4-nitro-

2H-Pyrrolo[2,3-b]pyridin-2-one, 1,3-dihydro-4-nitro-

CAS: 1638763-65-1

Formula: C₇H₅N₃O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.1329

Ref: IN-DA001UH3

4-Nitro-1H,2H,3H-pyrrolo[2,3-b]pyridin-2-one

CAS: 1638763-65-1

4-Nitro-1H,2H,3H-pyrrolo[2,3-b]pyridin-2-one

Molecular weight: 179.1329g/mol

Ref: 54-OR1021747

4-NITRO-1H,2H,3H-PYRROLO[2,3-B]PYRIDIN-2-ONE

CAS: 1638763-65-1

Purity: 95.0%

Molecular weight: 179.13499450683594

Ref: 10-F504520