CymitQuimica logo

CAS 1638763-69-5

:

1H-Pyrrolo[2,3-b]pyridine, 6-(chloromethyl)-1-methyl-, hydrochloride (1:1)

Description:
1H-Pyrrolo[2,3-b]pyridine, 6-(chloromethyl)-1-methyl-, hydrochloride (1:1), with CAS number 1638763-69-5, is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features a chloromethyl group at the 6-position and a methyl group at the 1-position of the pyrrolo ring, contributing to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including medicinal chemistry. The presence of the chloromethyl group suggests potential for further chemical modifications, making it a candidate for synthesis of more complex derivatives. Its structural features may impart specific pharmacological properties, making it of interest in drug development. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential applications. As with many chemical substances, proper handling and safety measures should be observed due to the presence of halogenated groups.
Formula:C9H9ClN2·ClH
InChI:InChI=1S/C9H9ClN2.ClH/c1-12-5-4-7-2-3-8(6-10)11-9(7)12;/h2-5H,6H2,1H3;1H
InChI key:InChIKey=MVKVCRZNRNQEMX-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC=C(CCl)N2)C=C1.Cl
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 6-(chloromethyl)-1-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.