CymitQuimica logo

CAS 1638764-15-4

:

4-Chloro-3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine

Description:
4-Chloro-3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrrole functionalities. The presence of a chlorine atom at the 4-position, a methyl group at the 3-position, and a nitro group at the 5-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its nitro group can participate in electrophilic substitution reactions, while the chlorine atom can serve as a leaving group in nucleophilic substitution reactions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyridine and pyrrole derivatives. Additionally, its molecular characteristics may influence its interactions with biological targets, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed, as with many halogenated and nitro-containing compounds, due to potential toxicity and environmental concerns.
Formula:C8H6ClN3O2
InChI:InChI=1S/C8H6ClN3O2/c1-4-2-10-8-6(4)7(9)5(3-11-8)12(13)14/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=DSFUDLWLGUPYPH-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=C1N(=O)=O)NC=C2C
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-3-methyl-5-nitro-
  • 4-Chloro-3-methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.