CAS 1638764-23-4

3-Bromothieno[3,2-b]pyridin-7-amine

Description:

3-Bromothieno[3,2-b]pyridin-7-amine is a heterocyclic organic compound characterized by the presence of a bromine atom, a thieno ring, and a pyridine structure. This compound features a fused bicyclic system, which contributes to its unique chemical properties and potential biological activity. The thieno ring introduces sulfur into the structure, enhancing its reactivity and solubility in various solvents. The amino group at the 7-position of the pyridine ring can participate in hydrogen bonding and nucleophilic reactions, making it a versatile building block in organic synthesis. The presence of the bromine atom can serve as a site for further substitution reactions, allowing for the introduction of diverse functional groups. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, 3-Bromothieno[3,2-b]pyridin-7-amine represents a significant structure in the field of organic and medicinal chemistry.

Formula: C₇H₅BrN₂S

InChI: InChI=1S/C7H5BrN2S/c8-4-3-11-7-5(9)1-2-10-6(4)7/h1-3H,(H2,9,10)

InChI key: InChIKey=UUIPOGIKTMGHIU-UHFFFAOYSA-N

SMILES: NC1=C2C(C(Br)=CS2)=NC=C1

Synonyms:

• Thieno[3,2-b]pyridin-7-amine, 3-bromo-
• 3-Bromothieno[3,2-b]pyridin-7-amine