CAS 1638764-36-9

2,4-Dichloro-5,7-dimethyl-7H-pyrrolo[2,3-d]pyrimidine

Description:

2,4-Dichloro-5,7-dimethyl-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features two chlorine atoms at the 2 and 4 positions and two methyl groups at the 5 and 7 positions, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. The presence of chlorine atoms can enhance its reactivity and influence its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Its potential applications could include roles as an intermediate in the synthesis of more complex molecules or as a bioactive agent, although specific biological activities would require further investigation.

Formula: C₈H₇Cl₂N₃

InChI: InChI=1S/C8H7Cl2N3/c1-4-3-13(2)7-5(4)6(9)11-8(10)12-7/h3H,1-2H3

InChI key: InChIKey=MBMIWDMRNZISLI-UHFFFAOYSA-N

SMILES: CN1C=2C(C(C)=C1)=C(Cl)N=C(Cl)N2

Synonyms:

• 7H-Pyrrolo[2,3-d]pyrimidine, 2,4-dichloro-5,7-dimethyl-
• 2,4-Dichloro-5,7-dimethyl-7H-pyrrolo[2,3-d]pyrimidine

7H-Pyrrolo[2,3-d]pyrimidine, 2,4-dichloro-5,7-dimethyl-

CAS: 1638764-36-9

Formula: C₈H₇Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.0673

Ref: IN-DA001UIA

2,4-Dichloro-5,7-dimethyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 1638764-36-9

2,4-Dichloro-5,7-dimethyl-7H-pyrrolo[2,3-d]pyrimidine

Purity: 97%

Molecular weight: 216.07g/mol

Ref: 54-OR1068982

2,4-Dichloro-5,7-dimethyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 1638764-36-9

Purity: 97%

Molecular weight: 216.0700073

Ref: 10-F695414