CAS 1638764-47-2

6-Chloro-1H-pyrrolo[2,3-b]pyridine-1-carboxamide

Description:

6-Chloro-1H-pyrrolo[2,3-b]pyridine-1-carboxamide is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. The presence of a chlorine atom at the 6-position of the pyrrole ring contributes to its reactivity and potential biological activity. The carboxamide functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit properties such as anti-inflammatory or anticancer activities. Its molecular structure allows for various modifications, which can be explored to optimize its pharmacological profile. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine substituent and the overall aromaticity of the bicyclic system. As with many heterocycles, it may also participate in various chemical reactions, making it a versatile building block in organic synthesis.

Formula: C₈H₆ClN₃O

InChI: InChI=1S/C8H6ClN3O/c9-6-2-1-5-3-4-12(8(10)13)7(5)11-6/h1-4H,(H2,10,13)

InChI key: InChIKey=COFIMCOPSBOKER-UHFFFAOYSA-N

SMILES: C(N)(=O)N1C=2C(C=C1)=CC=C(Cl)N2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-1-carboxamide, 6-chloro-
• 6-Chloro-1H-pyrrolo[2,3-b]pyridine-1-carboxamide