CAS 1638764-89-2

6-Chloro-1H-indazole-7-carboxylic acid

Description:

6-Chloro-1H-indazole-7-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position and a carboxylic acid functional group at the 7-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structure suggests potential for interactions with biological targets, making it of interest in drug discovery and development. The chlorine substituent can influence the compound's electronic properties and lipophilicity, affecting its pharmacokinetics and biological activity. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, which can be exploited for further synthetic modifications. Overall, 6-Chloro-1H-indazole-7-carboxylic acid represents a versatile scaffold in organic synthesis and pharmaceutical research.

Formula: C₈H₅ClN₂O₂

InChI: InChI=1S/C8H5ClN2O2/c9-5-2-1-4-3-10-11-7(4)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=DXQCSWBKYJAEIA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=CC=C1Cl)C=NN2

Synonyms:

• 1H-Indazole-7-carboxylic acid, 6-chloro-
• 6-Chloro-1H-indazole-7-carboxylic acid

6-Chloro-1H-indazole-7-carboxylic acid

CAS: 1638764-89-2

Versatile small molecule scaffold

Formula: C₈H₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 196.59 g/mol

Ref: 3D-NQC76489