
CAS 1638765-20-4
:1,1-Dimethylethyl 3,4-dihydro-6-hydroxy-1,1-dimethyl-2(1H)-isoquinolinecarboxylate
Description:
1,1-Dimethylethyl 3,4-dihydro-6-hydroxy-1,1-dimethyl-2(1H)-isoquinolinecarboxylate, identified by its CAS number 1638765-20-4, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance features a complex molecular structure characterized by the presence of a dimethyl group and a carboxylate functional group, which contribute to its chemical reactivity and potential biological activity. The hydroxy group indicates the presence of alcohol functionality, which can influence solubility and interaction with biological systems. The compound's isoquinoline core suggests potential applications in medicinal chemistry, as isoquinolines are known for their diverse pharmacological properties. Additionally, the presence of the tert-butyl group may enhance lipophilicity, affecting the compound's distribution in biological systems. Overall, this compound's unique structural features may provide avenues for research in drug development and other chemical applications, although specific biological activities and properties would require further investigation through empirical studies.
Formula:C16H23NO3
InChI:InChI=1S/C16H23NO3/c1-15(2,3)20-14(19)17-9-8-11-10-12(18)6-7-13(11)16(17,4)5/h6-7,10,18H,8-9H2,1-5H3
InChI key:InChIKey=HJRVKJMAOHLICV-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(CCN1C(OC(C)(C)C)=O)=CC(O)=CC2
Synonyms:- 2(1H)-Isoquinolinecarboxylic acid, 3,4-dihydro-6-hydroxy-1,1-dimethyl-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3,4-dihydro-6-hydroxy-1,1-dimethyl-2(1H)-isoquinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.