CAS 1638765-23-7

Spiro[3.3]heptane-2-methanamine, 6,6-difluoro-, hydrochloride (1:1)

Description:

Spiro[3.3]heptane-2-methanamine, 6,6-difluoro-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework with a nitrogen-containing amine functional group. The presence of two fluorine atoms at the 6-position enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound's spiro structure contributes to its rigidity, potentially affecting its conformational dynamics and interactions with biological targets. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. Overall, this compound may be of interest in medicinal chemistry and drug design, particularly in the development of novel therapeutics that leverage its unique structural features.

Formula: C₈H₁₃F₂N·ClH

InChI: InChI=1S/C8H13F2N.ClH/c9-8(10)4-7(5-8)1-6(2-7)3-11;/h6H,1-5,11H2;1H

InChI key: InChIKey=SENGGMYKHCCNQY-UHFFFAOYSA-N

SMILES: FC1(F)CC2(C1)CC(CN)C2.Cl

Synonyms:

• Spiro[3.3]heptane-2-methanamine, 6,6-difluoro-, hydrochloride (1:1)

{6,6-Difluorospiro[3.3]heptan-2-yl}methanamine hydrochloride

CAS: 1638765-23-7

{6,6-Difluorospiro[3.3]heptan-2-yl}methanamine hydrochloride

Purity: 95%

Molecular weight: 197.65g/mol

Ref: 54-PC102928

{6,6-Difluorospiro[3.3]heptan-2-yl}methanamine hydrochloride

CAS: 1638765-23-7

Versatile small molecule scaffold

Formula: C₈H₁₄ClF₂N

Purity: Min. 95%

Molecular weight: 197.65 g/mol

Ref: 3D-NQC76523