CAS 1638767-48-2
:7H-Pyrrolo[2,3-d]pyrimidin-2-amine, 6-iodo-7-methyl-
Description:
7H-Pyrrolo[2,3-d]pyrimidin-2-amine, 6-iodo-7-methyl- is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of an amino group at the 2-position and a methyl group at the 7-position contributes to its reactivity and potential biological activity. The iodine substituent at the 6-position enhances its lipophilicity and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyrrolo-pyrimidine scaffold can lead to compounds with diverse pharmacological properties. Its molecular structure suggests potential for hydrogen bonding and π-π stacking interactions, which are critical in biological systems. Additionally, the compound's stability and solubility characteristics can be influenced by the presence of the iodine atom and the overall electronic distribution within the molecule. As with many heterocycles, it may exhibit unique properties that warrant further investigation in various chemical and biological contexts.
Formula:C7H7IN4
InChI:InChI=1S/C7H7IN4/c1-12-5(8)2-4-3-10-7(9)11-6(4)12/h2-3H,1H3,(H2,9,10,11)
InChI key:InChIKey=RHVWSLGIGNKREE-UHFFFAOYSA-N
SMILES:CN1C=2C(C=C1I)=CN=C(N)N2
Synonyms:- 7H-Pyrrolo[2,3-d]pyrimidin-2-amine, 6-iodo-7-methyl-
- 6-Iodo-7-methyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.